C17H27BrN3O5P — CID 71811754
(2S)-2-[(4-bromophenyl)carbamoylamino]-N-(diethoxyphosphorylmethyl)pentanamide (PubChem CID 71811754) has the molecular formula C17H27BrN3O5P and a molecular weight of 464.30 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)carbamoylamino]-N-(diethoxyphosphorylmethyl)pentanamide.
| Compound Name | (2S)-2-[(4-bromophenyl)carbamoylamino]-N-(diethoxyphosphorylmethyl)pentanamide |
|---|---|
| PubChem CID | 71811754 |
| Molecular Formula | C17H27BrN3O5P |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)carbamoylamino]-N-(diethoxyphosphorylmethyl)pentanamide |
| SMILES | CCC[C@H](NC(=O)Nc1ccc(Br)cc1)C(=O)NCP(=O)(OCC)OCC |
| InChI | InChI=1S/C17H27BrN3O5P/c1-4-7-15(16(22)19-12-27(24,25-5-2)26-6-3)21-17(23)20-14-10-8-13(18)9-11-14/h8-11,15H,4-7,12H2,1-3H3,(H,19,22)(H2,20,21,23)/t15-/m0/s1 |
| InChIKey | BKLJUMMVLHXXSH-HNNXBMFYSA-N |
| XLogP | 4.08 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|