C26H34Br2N6O7P+ — CID 90387201
bis[[[(2S)-2-[(4-bromophenyl)carbamoylamino]pentanoyl]amino]methoxy]-oxophosphanium (PubChem CID 90387201) has the molecular formula C26H34Br2N6O7P+ and a molecular weight of 733.37 g/mol. Its IUPAC name is bis[[[(2S)-2-[(4-bromophenyl)carbamoylamino]pentanoyl]amino]methoxy]-oxophosphanium.
| Compound Name | bis[[[(2S)-2-[(4-bromophenyl)carbamoylamino]pentanoyl]amino]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 90387201 |
| Molecular Formula | C26H34Br2N6O7P+ |
| Molecular Weight | 733.37 g/mol |
| Exact Mass | 731.06 |
| IUPAC Name | bis[[[(2S)-2-[(4-bromophenyl)carbamoylamino]pentanoyl]amino]methoxy]-oxophosphanium |
| SMILES | CCC[C@H](NC(=O)Nc1ccc(Br)cc1)C(=O)NCO[P+](=O)OCNC(=O)[C@H](CCC)NC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C26H33Br2N6O7P/c1-3-5-21(33-25(37)31-19-11-7-17(27)8-12-19)23(35)29-15-40-42(39)41-16-30-24(36)22(6-4-2)34-26(38)32-20-13-9-18(28)10-14-20/h7-14,21-22H,3-6,15-16H2,1-2H3,(H5-,29,30,31,32,33,34,35,36,37,38)/p+1/t21-,22-/m0/s1 |
| InChIKey | XIPWUOYODMODIV-VXKWHMMOSA-O |
| XLogP | 5.33 |
| TPSA | 175.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|