C17H27BrN3O5P — CID 123948358
[[2-[(4-bromophenyl)carbamoylamino]-4-methylpentanoyl]amino]methyl-propan-2-yloxyphosphinic acid (PubChem CID 123948358) has the molecular formula C17H27BrN3O5P and a molecular weight of 464.30 g/mol. Its IUPAC name is [[2-[(4-bromophenyl)carbamoylamino]-4-methylpentanoyl]amino]methyl-propan-2-yloxyphosphinic acid.
| Compound Name | [[2-[(4-bromophenyl)carbamoylamino]-4-methylpentanoyl]amino]methyl-propan-2-yloxyphosphinic acid |
|---|---|
| PubChem CID | 123948358 |
| Molecular Formula | C17H27BrN3O5P |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | [[2-[(4-bromophenyl)carbamoylamino]-4-methylpentanoyl]amino]methyl-propan-2-yloxyphosphinic acid |
| SMILES | CC(C)CC(NC(=O)Nc1ccc(Br)cc1)C(=O)NCP(=O)(O)OC(C)C |
| InChI | InChI=1S/C17H27BrN3O5P/c1-11(2)9-15(16(22)19-10-27(24,25)26-12(3)4)21-17(23)20-14-7-5-13(18)6-8-14/h5-8,11-12,15H,9-10H2,1-4H3,(H,19,22)(H,24,25)(H2,20,21,23) |
| InChIKey | PEHBGUYWYZGJBH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|