C19H30BrN3O4 — CID 174822790
(2S)-2-[(4-bromophenyl)carbamoylamino]-4-methylpentanamide;tert-butyl acetate (PubChem CID 174822790) has the molecular formula C19H30BrN3O4 and a molecular weight of 444.37 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)carbamoylamino]-4-methylpentanamide;tert-butyl acetate.
| Compound Name | (2S)-2-[(4-bromophenyl)carbamoylamino]-4-methylpentanamide;tert-butyl acetate |
|---|---|
| PubChem CID | 174822790 |
| Molecular Formula | C19H30BrN3O4 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)carbamoylamino]-4-methylpentanamide;tert-butyl acetate |
| SMILES | CC(=O)OC(C)(C)C.CC(C)C[C@H](NC(=O)Nc1ccc(Br)cc1)C(N)=O |
| InChI | InChI=1S/C13H18BrN3O2.C6H12O2/c1-8(2)7-11(12(15)18)17-13(19)16-10-5-3-9(14)4-6-10;1-5(7)8-6(2,3)4/h3-6,8,11H,7H2,1-2H3,(H2,15,18)(H2,16,17,19);1-4H3/t11-;/m0./s1 |
| InChIKey | UNYXTEYDGOPSNG-MERQFXBCSA-N |
| XLogP | 3.82 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |