C15H22BrN2O3+ — CID 149168418
[2-[1-[(4-bromophenyl)carbamoylamino]ethyl]-4-methylpentanoyl]oxidanium (PubChem CID 149168418) has the molecular formula C15H22BrN2O3+ and a molecular weight of 358.26 g/mol. Its IUPAC name is [2-[1-[(4-bromophenyl)carbamoylamino]ethyl]-4-methylpentanoyl]oxidanium.
| Compound Name | [2-[1-[(4-bromophenyl)carbamoylamino]ethyl]-4-methylpentanoyl]oxidanium |
|---|---|
| PubChem CID | 149168418 |
| Molecular Formula | C15H22BrN2O3+ |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [2-[1-[(4-bromophenyl)carbamoylamino]ethyl]-4-methylpentanoyl]oxidanium |
| SMILES | CC(C)CC(C(=O)[OH2+])C(C)NC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H21BrN2O3/c1-9(2)8-13(14(19)20)10(3)17-15(21)18-12-6-4-11(16)5-7-12/h4-7,9-10,13H,8H2,1-3H3,(H,19,20)(H2,17,18,21)/p+1 |
| InChIKey | WYONEAMRJKMSKW-UHFFFAOYSA-O |
| XLogP | 2.87 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|