C21H31N3O6S — CID 58099949
1-[7-(benzenesulfonamido)-2-oxoheptan-3-yl]-3-(2,6-dioxoheptan-3-yl)urea (PubChem CID 58099949) has the molecular formula C21H31N3O6S and a molecular weight of 453.56 g/mol. Its IUPAC name is 1-[7-(benzenesulfonamido)-2-oxoheptan-3-yl]-3-(2,6-dioxoheptan-3-yl)urea.
| Compound Name | 1-[7-(benzenesulfonamido)-2-oxoheptan-3-yl]-3-(2,6-dioxoheptan-3-yl)urea |
|---|---|
| PubChem CID | 58099949 |
| Molecular Formula | C21H31N3O6S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1-[7-(benzenesulfonamido)-2-oxoheptan-3-yl]-3-(2,6-dioxoheptan-3-yl)urea |
| SMILES | CC(=O)CCC(NC(=O)NC(CCCCNS(=O)(=O)c1ccccc1)C(C)=O)C(C)=O |
| InChI | InChI=1S/C21H31N3O6S/c1-15(25)12-13-20(17(3)27)24-21(28)23-19(16(2)26)11-7-8-14-22-31(29,30)18-9-5-4-6-10-18/h4-6,9-10,19-20,22H,7-8,11-14H2,1-3H3,(H2,23,24,28) |
| InChIKey | IJMDOAKOBYLPEH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|