C23H39N3O5S — CID 123335789
1-[7-(benzenesulfonamido)heptan-3-yl]-3-(2,6-dioxoheptan-3-yl)urea;ethane (PubChem CID 123335789) has the molecular formula C23H39N3O5S and a molecular weight of 469.65 g/mol. Its IUPAC name is 1-[7-(benzenesulfonamido)heptan-3-yl]-3-(2,6-dioxoheptan-3-yl)urea;ethane.
| Compound Name | 1-[7-(benzenesulfonamido)heptan-3-yl]-3-(2,6-dioxoheptan-3-yl)urea;ethane |
|---|---|
| PubChem CID | 123335789 |
| Molecular Formula | C23H39N3O5S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 1-[7-(benzenesulfonamido)heptan-3-yl]-3-(2,6-dioxoheptan-3-yl)urea;ethane |
| SMILES | CC.CCC(CCCCNS(=O)(=O)c1ccccc1)NC(=O)NC(CCC(C)=O)C(C)=O |
| InChI | InChI=1S/C21H33N3O5S.C2H6/c1-4-18(23-21(27)24-20(17(3)26)14-13-16(2)25)10-8-9-15-22-30(28,29)19-11-6-5-7-12-19;1-2/h5-7,11-12,18,20,22H,4,8-10,13-15H2,1-3H3,(H2,23,24,27);1-2H3 |
| InChIKey | GYHRBXUPOFZDCZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|