C20H26AlN3O8 — CID 145300709
(2S)-2-[[1-carboxy-5-[(3-methylidenealumanylbenzoyl)amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 145300709) has the molecular formula C20H26AlN3O8 and a molecular weight of 463.42 g/mol. Its IUPAC name is (2S)-2-[[1-carboxy-5-[(3-methylidenealumanylbenzoyl)amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[1-carboxy-5-[(3-methylidenealumanylbenzoyl)amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 145300709 |
| Molecular Formula | C20H26AlN3O8 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | (2S)-2-[[1-carboxy-5-[(3-methylidenealumanylbenzoyl)amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | C=[Al]c1cccc(C(=O)NCCCCC(NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C19H24N3O8.CH2.Al/c23-15(24)10-9-14(18(28)29)22-19(30)21-13(17(26)27)8-4-5-11-20-16(25)12-6-2-1-3-7-12;;/h1-2,6-7,13-14H,4-5,8-11H2,(H,20,25)(H,23,24)(H,26,27)(H,28,29)(H2,21,22,30);1H2;/t13?,14-;;/m0../s1 |
| InChIKey | RYMDKQPJJWOZEV-HNYZGNTBSA-N |
| XLogP | -0.58 |
| TPSA | 182.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|