C20H29N3O8 — CID 130459847
2-[[1-carboxy-5-[(4-methylcyclohexa-1,3-diene-1-carbonyl)amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 130459847) has the molecular formula C20H29N3O8 and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-[[1-carboxy-5-[(4-methylcyclohexa-1,3-diene-1-carbonyl)amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[1-carboxy-5-[(4-methylcyclohexa-1,3-diene-1-carbonyl)amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 130459847 |
| Molecular Formula | C20H29N3O8 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2-[[1-carboxy-5-[(4-methylcyclohexa-1,3-diene-1-carbonyl)amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | CC1=CC=C(C(=O)NCCCCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C20H29N3O8/c1-12-5-7-13(8-6-12)17(26)21-11-3-2-4-14(18(27)28)22-20(31)23-15(19(29)30)9-10-16(24)25/h5,7,14-15H,2-4,6,8-11H2,1H3,(H,21,26)(H,24,25)(H,27,28)(H,29,30)(H2,22,23,31) |
| InChIKey | VGFMZUMXTGTPPE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 182.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|