C44H65N7O11 — CID 146505753
2-[[1-carboxy-5-[8-[[2-[[2-[5-(methylamino)pentanoylamino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]octanoylamino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 146505753) has the molecular formula C44H65N7O11 and a molecular weight of 868.04 g/mol. Its IUPAC name is 2-[[1-carboxy-5-[8-[[2-[[2-[5-(methylamino)pentanoylamino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]octanoylamino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[1-carboxy-5-[8-[[2-[[2-[5-(methylamino)pentanoylamino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]octanoylamino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 146505753 |
| Molecular Formula | C44H65N7O11 |
| Molecular Weight | 868.04 g/mol |
| Exact Mass | 867.47 |
| IUPAC Name | 2-[[1-carboxy-5-[8-[[2-[[2-[5-(methylamino)pentanoylamino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]octanoylamino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | CNCCCCC(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NCCCCCCCC(=O)NCCCCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C44H65N7O11/c1-45-26-15-13-23-38(53)48-36(30-32-19-9-6-10-20-32)41(57)49-35(29-31-17-7-5-8-18-31)40(56)47-28-14-4-2-3-11-22-37(52)46-27-16-12-21-33(42(58)59)50-44(62)51-34(43(60)61)24-25-39(54)55/h5-10,17-20,33-36,45H,2-4,11-16,21-30H2,1H3,(H,46,52)(H,47,56)(H,48,53)(H,49,57)(H,54,55)(H,58,59)(H,60,61)(H2,50,51,62) |
| InChIKey | VWRZUYWSWWXERK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 281.46 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.04 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|