C34H48N4O6 — CID 171107920
2-[[2-[[2-(methylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-6-(8-oxononanoylamino)hexanoic acid (PubChem CID 171107920) has the molecular formula C34H48N4O6 and a molecular weight of 608.78 g/mol. Its IUPAC name is 2-[[2-[[2-(methylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-6-(8-oxononanoylamino)hexanoic acid.
| Compound Name | 2-[[2-[[2-(methylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-6-(8-oxononanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 171107920 |
| Molecular Formula | C34H48N4O6 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.36 |
| IUPAC Name | 2-[[2-[[2-(methylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-6-(8-oxononanoylamino)hexanoic acid |
| SMILES | CNC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCNC(=O)CCCCCCC(C)=O)C(=O)O |
| InChI | InChI=1S/C34H48N4O6/c1-25(39)15-7-3-4-12-21-31(40)36-22-14-13-20-28(34(43)44)37-33(42)30(24-27-18-10-6-11-19-27)38-32(41)29(35-2)23-26-16-8-5-9-17-26/h5-6,8-11,16-19,28-30,35H,3-4,7,12-15,20-24H2,1-2H3,(H,36,40)(H,37,42)(H,38,41)(H,43,44) |
| InChIKey | CFJXWWYQAAFGLB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|