C39H62N4O7 — CID 171107950
ethane;3-(4-hydroxy-3-methylphenyl)-2-(methylamino)-N-(1-oxo-3-phenylpropan-2-yl)propanamide;2-(methylamino)-6-(8-oxodecanoylamino)hexanoic acid (PubChem CID 171107950) has the molecular formula C39H62N4O7 and a molecular weight of 698.95 g/mol. Its IUPAC name is ethane;3-(4-hydroxy-3-methylphenyl)-2-(methylamino)-N-(1-oxo-3-phenylpropan-2-yl)propanamide;2-(methylamino)-6-(8-oxodecanoylamino)hexanoic acid.
| Compound Name | ethane;3-(4-hydroxy-3-methylphenyl)-2-(methylamino)-N-(1-oxo-3-phenylpropan-2-yl)propanamide;2-(methylamino)-6-(8-oxodecanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 171107950 |
| Molecular Formula | C39H62N4O7 |
| Molecular Weight | 698.95 g/mol |
| Exact Mass | 698.46 |
| IUPAC Name | ethane;3-(4-hydroxy-3-methylphenyl)-2-(methylamino)-N-(1-oxo-3-phenylpropan-2-yl)propanamide;2-(methylamino)-6-(8-oxodecanoylamino)hexanoic acid |
| SMILES | CC.CCC(=O)CCCCCCC(=O)NCCCCC(NC)C(=O)O.CNC(Cc1ccc(O)c(C)c1)C(=O)NC(C=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H24N2O3.C17H32N2O4.C2H6/c1-14-10-16(8-9-19(14)24)12-18(21-2)20(25)22-17(13-23)11-15-6-4-3-5-7-15;1-3-14(20)10-6-4-5-7-12-16(21)19-13-9-8-11-15(18-2)17(22)23;1-2/h3-10,13,17-18,21,24H,11-12H2,1-2H3,(H,22,25);15,18H,3-13H2,1-2H3,(H,19,21)(H,22,23);1-2H3 |
| InChIKey | QILKTIJQFUEBAE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 173.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.95 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|