C37H54N4O7 — CID 171107932
2-[[2-[[3-(4-hydroxy-3-methylphenyl)-2-(methylamino)propanoyl]amino]-3-phenylpropanoyl]amino]-6-[(9-methyl-8-oxodecanoyl)amino]hexanoic acid (PubChem CID 171107932) has the molecular formula C37H54N4O7 and a molecular weight of 666.86 g/mol. Its IUPAC name is 2-[[2-[[3-(4-hydroxy-3-methylphenyl)-2-(methylamino)propanoyl]amino]-3-phenylpropanoyl]amino]-6-[(9-methyl-8-oxodecanoyl)amino]hexanoic acid.
| Compound Name | 2-[[2-[[3-(4-hydroxy-3-methylphenyl)-2-(methylamino)propanoyl]amino]-3-phenylpropanoyl]amino]-6-[(9-methyl-8-oxodecanoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 171107932 |
| Molecular Formula | C37H54N4O7 |
| Molecular Weight | 666.86 g/mol |
| Exact Mass | 666.40 |
| IUPAC Name | 2-[[2-[[3-(4-hydroxy-3-methylphenyl)-2-(methylamino)propanoyl]amino]-3-phenylpropanoyl]amino]-6-[(9-methyl-8-oxodecanoyl)amino]hexanoic acid |
| SMILES | CNC(Cc1ccc(O)c(C)c1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCNC(=O)CCCCCCC(=O)C(C)C)C(=O)O |
| InChI | InChI=1S/C37H54N4O7/c1-25(2)32(42)17-10-5-6-11-18-34(44)39-21-13-12-16-29(37(47)48)40-36(46)31(23-27-14-8-7-9-15-27)41-35(45)30(38-4)24-28-19-20-33(43)26(3)22-28/h7-9,14-15,19-20,22,25,29-31,38,43H,5-6,10-13,16-18,21,23-24H2,1-4H3,(H,39,44)(H,40,46)(H,41,45)(H,47,48) |
| InChIKey | DLHDCQFEQWUZCB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 173.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.86 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|