C26H37N3O2 — CID 171640025
5-[[2-(methylamino)-3-(4-phenylphenyl)propanoyl]amino]-N-pentylpentanamide (PubChem CID 171640025) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is 5-[[2-(methylamino)-3-(4-phenylphenyl)propanoyl]amino]-N-pentylpentanamide.
| Compound Name | 5-[[2-(methylamino)-3-(4-phenylphenyl)propanoyl]amino]-N-pentylpentanamide |
|---|---|
| PubChem CID | 171640025 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | 5-[[2-(methylamino)-3-(4-phenylphenyl)propanoyl]amino]-N-pentylpentanamide |
| SMILES | CCCCCNC(=O)CCCCNC(=O)C(Cc1ccc(-c2ccccc2)cc1)NC |
| InChI | InChI=1S/C26H37N3O2/c1-3-4-9-18-28-25(30)13-8-10-19-29-26(31)24(27-2)20-21-14-16-23(17-15-21)22-11-6-5-7-12-22/h5-7,11-12,14-17,24,27H,3-4,8-10,13,18-20H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | ZBJLZEGXLJXQOA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|