C14H17FN4O6 — CID 158975913
(2S)-2-[2-[(6-(18F)fluoropyridine-3-carbonyl)amino]ethylcarbamoylamino]pentanedioic acid (PubChem CID 158975913) has the molecular formula C14H17FN4O6 and a molecular weight of 355.31 g/mol. Its IUPAC name is (2S)-2-[2-[(6-(18F)fluoropyridine-3-carbonyl)amino]ethylcarbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[2-[(6-(18F)fluoropyridine-3-carbonyl)amino]ethylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 158975913 |
| Molecular Formula | C14H17FN4O6 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | (2S)-2-[2-[(6-(18F)fluoropyridine-3-carbonyl)amino]ethylcarbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)NCCNC(=O)c1ccc([18F])nc1)C(=O)O |
| InChI | InChI=1S/C14H17FN4O6/c15-10-3-1-8(7-18-10)12(22)16-5-6-17-14(25)19-9(13(23)24)2-4-11(20)21/h1,3,7,9H,2,4-6H2,(H,16,22)(H,20,21)(H,23,24)(H2,17,19,25)/t9-/m0/s1/i15-1 |
| InChIKey | PSIGPYFQGXOUNO-HLVCDFNBSA-N |
| XLogP | -0.43 |
| TPSA | 157.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|