C12H14FN5O6 — CID 130432485
(2S)-2-[2-[(6-(18F)fluoropyridazine-3-carbonyl)amino]ethylcarbamoylamino]butanedioic acid (PubChem CID 130432485) has the molecular formula C12H14FN5O6 and a molecular weight of 342.27 g/mol. Its IUPAC name is (2S)-2-[2-[(6-(18F)fluoropyridazine-3-carbonyl)amino]ethylcarbamoylamino]butanedioic acid.
| Compound Name | (2S)-2-[2-[(6-(18F)fluoropyridazine-3-carbonyl)amino]ethylcarbamoylamino]butanedioic acid |
|---|---|
| PubChem CID | 130432485 |
| Molecular Formula | C12H14FN5O6 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (2S)-2-[2-[(6-(18F)fluoropyridazine-3-carbonyl)amino]ethylcarbamoylamino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)NCCNC(=O)c1ccc([18F])nn1)C(=O)O |
| InChI | InChI=1S/C12H14FN5O6/c13-8-2-1-6(17-18-8)10(21)14-3-4-15-12(24)16-7(11(22)23)5-9(19)20/h1-2,7H,3-5H2,(H,14,21)(H,19,20)(H,22,23)(H2,15,16,24)/t7-/m0/s1/i13-1 |
| InChIKey | FRWYRMQZMSEGJP-RJAXKLMTSA-N |
| XLogP | -1.43 |
| TPSA | 170.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|