C10H12N4O5 — CID 106897236
(2S)-2-(pyridazin-3-ylmethylcarbamoylamino)butanedioic acid (PubChem CID 106897236) has the molecular formula C10H12N4O5 and a molecular weight of 268.23 g/mol. Its IUPAC name is (2S)-2-(pyridazin-3-ylmethylcarbamoylamino)butanedioic acid.
| Compound Name | (2S)-2-(pyridazin-3-ylmethylcarbamoylamino)butanedioic acid |
|---|---|
| PubChem CID | 106897236 |
| Molecular Formula | C10H12N4O5 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (2S)-2-(pyridazin-3-ylmethylcarbamoylamino)butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)NCc1cccnn1)C(=O)O |
| InChI | InChI=1S/C10H12N4O5/c15-8(16)4-7(9(17)18)13-10(19)11-5-6-2-1-3-12-14-6/h1-3,7H,4-5H2,(H,15,16)(H,17,18)(H2,11,13,19)/t7-/m0/s1 |
| InChIKey | JJHFMBYCXADNRU-ZETCQYMHSA-N |
| XLogP | -0.80 |
| TPSA | 141.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |