C11H9ClFNO5 — CID 113226112
(2S)-2-[(2-chloro-6-fluorobenzoyl)amino]butanedioic acid (PubChem CID 113226112) has the molecular formula C11H9ClFNO5 and a molecular weight of 289.65 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-6-fluorobenzoyl)amino]butanedioic acid.
| Compound Name | (2S)-2-[(2-chloro-6-fluorobenzoyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 113226112 |
| Molecular Formula | C11H9ClFNO5 |
| Molecular Weight | 289.65 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | (2S)-2-[(2-chloro-6-fluorobenzoyl)amino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)c1c(F)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H9ClFNO5/c12-5-2-1-3-6(13)9(5)10(17)14-7(11(18)19)4-8(15)16/h1-3,7H,4H2,(H,14,17)(H,15,16)(H,18,19)/t7-/m0/s1 |
| InChIKey | BYOWKCBJKKFWJP-ZETCQYMHSA-N |
| XLogP | 1.14 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.65 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |