C25H28FN5O10 — CID 155338465
2-[[[1-carboxy-5-[[4-[(6-fluoropyridine-3-carbonyl)amino]benzoyl]amino]pentyl]-hydroxycarbamoyl]amino]pentanedioic acid (PubChem CID 155338465) has the molecular formula C25H28FN5O10 and a molecular weight of 577.52 g/mol. Its IUPAC name is 2-[[[1-carboxy-5-[[4-[(6-fluoropyridine-3-carbonyl)amino]benzoyl]amino]pentyl]-hydroxycarbamoyl]amino]pentanedioic acid.
| Compound Name | 2-[[[1-carboxy-5-[[4-[(6-fluoropyridine-3-carbonyl)amino]benzoyl]amino]pentyl]-hydroxycarbamoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 155338465 |
| Molecular Formula | C25H28FN5O10 |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | 2-[[[1-carboxy-5-[[4-[(6-fluoropyridine-3-carbonyl)amino]benzoyl]amino]pentyl]-hydroxycarbamoyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)N(O)C(CCCCNC(=O)c1ccc(NC(=O)c2ccc(F)nc2)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C25H28FN5O10/c26-19-10-6-15(13-28-19)22(35)29-16-7-4-14(5-8-16)21(34)27-12-2-1-3-18(24(38)39)31(41)25(40)30-17(23(36)37)9-11-20(32)33/h4-8,10,13,17-18,41H,1-3,9,11-12H2,(H,27,34)(H,29,35)(H,30,40)(H,32,33)(H,36,37)(H,38,39) |
| InChIKey | HLLWNBVFLHKBIH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 235.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|