C30H37ClIN3O9 — CID 158215107
(2S)-2-[[(1S)-1-carboxybutyl]carbamoyloxy]-6-[[4-chloro-2-[4-[(4-iodobenzoyl)amino]butoxy]benzoyl]amino]hexanoic acid (PubChem CID 158215107) has the molecular formula C30H37ClIN3O9 and a molecular weight of 746.00 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxybutyl]carbamoyloxy]-6-[[4-chloro-2-[4-[(4-iodobenzoyl)amino]butoxy]benzoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxybutyl]carbamoyloxy]-6-[[4-chloro-2-[4-[(4-iodobenzoyl)amino]butoxy]benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 158215107 |
| Molecular Formula | C30H37ClIN3O9 |
| Molecular Weight | 746.00 g/mol |
| Exact Mass | 745.13 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxybutyl]carbamoyloxy]-6-[[4-chloro-2-[4-[(4-iodobenzoyl)amino]butoxy]benzoyl]amino]hexanoic acid |
| SMILES | CCC[C@H](NC(=O)O[C@@H](CCCCNC(=O)c1ccc(Cl)cc1OCCCCNC(=O)c1ccc(I)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C30H37ClIN3O9/c1-2-7-23(28(38)39)35-30(42)44-24(29(40)41)8-3-4-15-34-27(37)22-14-11-20(31)18-25(22)43-17-6-5-16-33-26(36)19-9-12-21(32)13-10-19/h9-14,18,23-24H,2-8,15-17H2,1H3,(H,33,36)(H,34,37)(H,35,42)(H,38,39)(H,40,41)/t23-,24-/m0/s1 |
| InChIKey | LFODOTVLTIOXQA-ZEQRLZLVSA-N |
| XLogP | 4.87 |
| TPSA | 180.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.00 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|