C28H30N4O2 — CID 24776772
N-hexyl-2-[(2E)-2-[(4-methoxynaphthalen-1-yl)methylidene]hydrazinyl]quinoline-4-carboxamide (PubChem CID 24776772) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-hexyl-2-[(2E)-2-[(4-methoxynaphthalen-1-yl)methylidene]hydrazinyl]quinoline-4-carboxamide.
| Compound Name | N-hexyl-2-[(2E)-2-[(4-methoxynaphthalen-1-yl)methylidene]hydrazinyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 24776772 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | N-hexyl-2-[(2E)-2-[(4-methoxynaphthalen-1-yl)methylidene]hydrazinyl]quinoline-4-carboxamide |
| SMILES | CCCCCCNC(=O)c1cc(N/N=C/c2ccc(OC)c3ccccc23)nc2ccccc12 |
| InChI | InChI=1S/C28H30N4O2/c1-3-4-5-10-17-29-28(33)24-18-27(31-25-14-9-8-12-22(24)25)32-30-19-20-15-16-26(34-2)23-13-7-6-11-21(20)23/h6-9,11-16,18-19H,3-5,10,17H2,1-2H3,(H,29,33)(H,31,32)/b30-19+ |
| InChIKey | DQIJMDHQLXFZLV-NDZAJKAJSA-N |
| XLogP | 6.15 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|