C28H33N5O — CID 3393283
6-benzyl-N-[3-(N-ethyl-3-methylanilino)propyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 3393283) has the molecular formula C28H33N5O and a molecular weight of 455.61 g/mol. Its IUPAC name is 6-benzyl-N-[3-(N-ethyl-3-methylanilino)propyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 6-benzyl-N-[3-(N-ethyl-3-methylanilino)propyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 3393283 |
| Molecular Formula | C28H33N5O |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 6-benzyl-N-[3-(N-ethyl-3-methylanilino)propyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCN(CCCNC(=O)c1cnn2c(C)c(Cc3ccccc3)c(C)nc12)c1cccc(C)c1 |
| InChI | InChI=1S/C28H33N5O/c1-5-32(24-14-9-11-20(2)17-24)16-10-15-29-28(34)26-19-30-33-22(4)25(21(3)31-27(26)33)18-23-12-7-6-8-13-23/h6-9,11-14,17,19H,5,10,15-16,18H2,1-4H3,(H,29,34) |
| InChIKey | BOIJVXAUCUUWNZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|