C25H27N3O2 — CID 20853528
N-[3-(N-ethyl-3-methylanilino)propyl]-7-methylfuro[2,3-b]quinoline-2-carboxamide (PubChem CID 20853528) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[3-(N-ethyl-3-methylanilino)propyl]-7-methylfuro[2,3-b]quinoline-2-carboxamide.
| Compound Name | N-[3-(N-ethyl-3-methylanilino)propyl]-7-methylfuro[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 20853528 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-[3-(N-ethyl-3-methylanilino)propyl]-7-methylfuro[2,3-b]quinoline-2-carboxamide |
| SMILES | CCN(CCCNC(=O)c1cc2cc3ccc(C)cc3nc2o1)c1cccc(C)c1 |
| InChI | InChI=1S/C25H27N3O2/c1-4-28(21-8-5-7-17(2)13-21)12-6-11-26-24(29)23-16-20-15-19-10-9-18(3)14-22(19)27-25(20)30-23/h5,7-10,13-16H,4,6,11-12H2,1-3H3,(H,26,29) |
| InChIKey | OSYNAKGXQLBTMW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|