C21H30N2 — CID 57172568
N,N'-diethyl-N,N'-bis(3-methylphenyl)propane-1,3-diamine (PubChem CID 57172568) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is N,N'-diethyl-N,N'-bis(3-methylphenyl)propane-1,3-diamine.
| Compound Name | N,N'-diethyl-N,N'-bis(3-methylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 57172568 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | N,N'-diethyl-N,N'-bis(3-methylphenyl)propane-1,3-diamine |
| SMILES | CCN(CCCN(CC)c1cccc(C)c1)c1cccc(C)c1 |
| InChI | InChI=1S/C21H30N2/c1-5-22(20-12-7-10-18(3)16-20)14-9-15-23(6-2)21-13-8-11-19(4)17-21/h7-8,10-13,16-17H,5-6,9,14-15H2,1-4H3 |
| InChIKey | HWTXHWAQUVZQED-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |