C24H36N2 — CID 91719494
N,N'-diethyl-N,N'-bis(3-methylphenyl)hexane-1,6-diamine (PubChem CID 91719494) has the molecular formula C24H36N2 and a molecular weight of 352.57 g/mol. Its IUPAC name is N,N'-diethyl-N,N'-bis(3-methylphenyl)hexane-1,6-diamine.
| Compound Name | N,N'-diethyl-N,N'-bis(3-methylphenyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 91719494 |
| Molecular Formula | C24H36N2 |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.29 |
| IUPAC Name | N,N'-diethyl-N,N'-bis(3-methylphenyl)hexane-1,6-diamine |
| SMILES | CCN(CCCCCCN(CC)c1cccc(C)c1)c1cccc(C)c1 |
| InChI | InChI=1S/C24H36N2/c1-5-25(23-15-11-13-21(3)19-23)17-9-7-8-10-18-26(6-2)24-16-12-14-22(4)20-24/h11-16,19-20H,5-10,17-18H2,1-4H3 |
| InChIKey | CRFTWHBMGJTJHX-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|