C15H25N — CID 15332677
N,N-dibutyl-3-methylaniline (PubChem CID 15332677) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N,N-dibutyl-3-methylaniline.
| Compound Name | N,N-dibutyl-3-methylaniline |
|---|---|
| PubChem CID | 15332677 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N,N-dibutyl-3-methylaniline |
| SMILES | CCCCN(CCCC)c1cccc(C)c1 |
| InChI | InChI=1S/C15H25N/c1-4-6-11-16(12-7-5-2)15-10-8-9-14(3)13-15/h8-10,13H,4-7,11-12H2,1-3H3 |
| InChIKey | MUKJUKMSNRJVBD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |