C15H23NO — CID 21321486
3-(dibutylamino)cyclohepta-2,4,6-trien-1-one (PubChem CID 21321486) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is 3-(dibutylamino)cyclohepta-2,4,6-trien-1-one.
| Compound Name | 3-(dibutylamino)cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 21321486 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 3-(dibutylamino)cyclohepta-2,4,6-trien-1-one |
| SMILES | CCCCN(CCCC)c1ccccc(=O)c1 |
| InChI | InChI=1S/C15H23NO/c1-3-5-11-16(12-6-4-2)14-9-7-8-10-15(17)13-14/h7-10,13H,3-6,11-12H2,1-2H3 |
| InChIKey | JQAHXLJGRSMOMW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |