C14H23ClN2O2 — CID 163332973
N,N-dibutyl-3-nitroaniline;hydrochloride (PubChem CID 163332973) has the molecular formula C14H23ClN2O2 and a molecular weight of 286.80 g/mol. Its IUPAC name is N,N-dibutyl-3-nitroaniline;hydrochloride.
| Compound Name | N,N-dibutyl-3-nitroaniline;hydrochloride |
|---|---|
| PubChem CID | 163332973 |
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N,N-dibutyl-3-nitroaniline;hydrochloride |
| SMILES | CCCCN(CCCC)c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C14H22N2O2.ClH/c1-3-5-10-15(11-6-4-2)13-8-7-9-14(12-13)16(17)18;/h7-9,12H,3-6,10-11H2,1-2H3;1H |
| InChIKey | QCVCKFWIZITLSF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|