C13H21N3O2 — CID 164526082
N,N-dibutyl-6-nitropyridin-3-amine (PubChem CID 164526082) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is N,N-dibutyl-6-nitropyridin-3-amine.
| Compound Name | N,N-dibutyl-6-nitropyridin-3-amine |
|---|---|
| PubChem CID | 164526082 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | N,N-dibutyl-6-nitropyridin-3-amine |
| SMILES | CCCCN(CCCC)c1ccc([N+](=O)[O-])nc1 |
| InChI | InChI=1S/C13H21N3O2/c1-3-5-9-15(10-6-4-2)12-7-8-13(14-11-12)16(17)18/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | JIWITTQCYRNOHZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|