C25H29N3O2 — CID 92660908
N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(2-methoxyanilino)quinoline-4-carboxamide (PubChem CID 92660908) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(2-methoxyanilino)quinoline-4-carboxamide.
| Compound Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(2-methoxyanilino)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 92660908 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(2-methoxyanilino)quinoline-4-carboxamide |
| SMILES | COc1ccccc1Nc1cc(C(=O)N[C@@H]2CCC[C@@H](C)[C@@H]2C)c2ccccc2n1 |
| InChI | InChI=1S/C25H29N3O2/c1-16-9-8-13-20(17(16)2)28-25(29)19-15-24(26-21-11-5-4-10-18(19)21)27-22-12-6-7-14-23(22)30-3/h4-7,10-12,14-17,20H,8-9,13H2,1-3H3,(H,26,27)(H,28,29)/t16-,17+,20-/m1/s1 |
| InChIKey | SEAJQKUKYIKKCM-FUHIMQAGSA-N |
| XLogP | 5.54 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |