C23H27N3O5 — CID 70343441
N-(2,2-dimethoxyethyl)-2-[2-(1-hydroxyethyl)-4-methoxyanilino]quinoline-4-carboxamide (PubChem CID 70343441) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-[2-(1-hydroxyethyl)-4-methoxyanilino]quinoline-4-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-2-[2-(1-hydroxyethyl)-4-methoxyanilino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 70343441 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-[2-(1-hydroxyethyl)-4-methoxyanilino]quinoline-4-carboxamide |
| SMILES | COc1ccc(Nc2cc(C(=O)NCC(OC)OC)c3ccccc3n2)c(C(C)O)c1 |
| InChI | InChI=1S/C23H27N3O5/c1-14(27)17-11-15(29-2)9-10-20(17)26-21-12-18(16-7-5-6-8-19(16)25-21)23(28)24-13-22(30-3)31-4/h5-12,14,22,27H,13H2,1-4H3,(H,24,28)(H,25,26) |
| InChIKey | GKZHAJOILJWUSJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|