C28H26N4O4 — CID 70166799
2-N,3-N-bis(2,5-dimethoxyphenyl)benzo[g]quinoxaline-2,3-diamine (PubChem CID 70166799) has the molecular formula C28H26N4O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is 2-N,3-N-bis(2,5-dimethoxyphenyl)benzo[g]quinoxaline-2,3-diamine.
| Compound Name | 2-N,3-N-bis(2,5-dimethoxyphenyl)benzo[g]quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 70166799 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 2-N,3-N-bis(2,5-dimethoxyphenyl)benzo[g]quinoxaline-2,3-diamine |
| SMILES | COc1ccc(OC)c(Nc2nc3cc4ccccc4cc3nc2Nc2cc(OC)ccc2OC)c1 |
| InChI | InChI=1S/C28H26N4O4/c1-33-19-9-11-25(35-3)23(15-19)31-27-28(32-24-16-20(34-2)10-12-26(24)36-4)30-22-14-18-8-6-5-7-17(18)13-21(22)29-27/h5-16H,1-4H3,(H,29,31)(H,30,32) |
| InChIKey | MGDFPHFBDQQBNX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|