C22H18FN3O2 — CID 1393536
N-(2,5-dimethoxyphenyl)-2-(2-fluorophenyl)quinazolin-4-amine (PubChem CID 1393536) has the molecular formula C22H18FN3O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-(2-fluorophenyl)quinazolin-4-amine.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-(2-fluorophenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 1393536 |
| Molecular Formula | C22H18FN3O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-(2-fluorophenyl)quinazolin-4-amine |
| SMILES | COc1ccc(OC)c(Nc2nc(-c3ccccc3F)nc3ccccc23)c1 |
| InChI | InChI=1S/C22H18FN3O2/c1-27-14-11-12-20(28-2)19(13-14)25-22-16-8-4-6-10-18(16)24-21(26-22)15-7-3-5-9-17(15)23/h3-13H,1-2H3,(H,24,25,26) |
| InChIKey | KARBXNRTAMAYQS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |