C24H21FN4O2 — CID 6062421
N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]-2-(2-fluorophenyl)quinazolin-4-amine (PubChem CID 6062421) has the molecular formula C24H21FN4O2 and a molecular weight of 416.46 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]-2-(2-fluorophenyl)quinazolin-4-amine.
| Compound Name | N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]-2-(2-fluorophenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 6062421 |
| Molecular Formula | C24H21FN4O2 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]-2-(2-fluorophenyl)quinazolin-4-amine |
| SMILES | COc1ccc(/C(C)=N\Nc2nc(-c3ccccc3F)nc3ccccc23)cc1OC |
| InChI | InChI=1S/C24H21FN4O2/c1-15(16-12-13-21(30-2)22(14-16)31-3)28-29-24-18-9-5-7-11-20(18)26-23(27-24)17-8-4-6-10-19(17)25/h4-14H,1-3H3,(H,26,27,29)/b28-15- |
| InChIKey | JQIHYTSTKYSKFD-MBTHVWNTSA-N |
| XLogP | 5.29 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|