C11H14N6O2 — CID 5035855
N-[1-(3,4-dimethoxyphenyl)ethylideneamino]-2H-tetrazol-5-amine (PubChem CID 5035855) has the molecular formula C11H14N6O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethylideneamino]-2H-tetrazol-5-amine.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethylideneamino]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 5035855 |
| Molecular Formula | C11H14N6O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethylideneamino]-2H-tetrazol-5-amine |
| SMILES | COc1ccc(C(C)=NNc2nn[nH]n2)cc1OC |
| InChI | InChI=1S/C11H14N6O2/c1-7(12-13-11-14-16-17-15-11)8-4-5-9(18-2)10(6-8)19-3/h4-6H,1-3H3,(H2,13,14,15,16,17) |
| InChIKey | YZHVKSRBJXUFNV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|