C20H22FN7O3S — CID 17074879
2-[[4-amino-5-[(2E)-2-[1-(3,4-dimethoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-fluorophenyl)acetamide (PubChem CID 17074879) has the molecular formula C20H22FN7O3S and a molecular weight of 459.51 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[1-(3,4-dimethoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[1-(3,4-dimethoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 17074879 |
| Molecular Formula | C20H22FN7O3S |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[1-(3,4-dimethoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1ccc(/C(C)=N/Nc2nnc(SCC(=O)Nc3ccc(F)cc3)n2N)cc1OC |
| InChI | InChI=1S/C20H22FN7O3S/c1-12(13-4-9-16(30-2)17(10-13)31-3)24-25-19-26-27-20(28(19)22)32-11-18(29)23-15-7-5-14(21)6-8-15/h4-10H,11,22H2,1-3H3,(H,23,29)(H,25,26)/b24-12+ |
| InChIKey | FGWDDGNMPQNNBW-WYMPLXKRSA-N |
| XLogP | 2.72 |
| TPSA | 128.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|