C20H22N8O5S — CID 17074875
2-[[4-amino-5-[(2E)-2-[1-(3,4-dimethoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide (PubChem CID 17074875) has the molecular formula C20H22N8O5S and a molecular weight of 486.51 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[1-(3,4-dimethoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[1-(3,4-dimethoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 17074875 |
| Molecular Formula | C20H22N8O5S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[1-(3,4-dimethoxyphenyl)ethylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide |
| SMILES | COc1ccc(/C(C)=N/Nc2nnc(SCC(=O)Nc3cccc([N+](=O)[O-])c3)n2N)cc1OC |
| InChI | InChI=1S/C20H22N8O5S/c1-12(13-7-8-16(32-2)17(9-13)33-3)23-24-19-25-26-20(27(19)21)34-11-18(29)22-14-5-4-6-15(10-14)28(30)31/h4-10H,11,21H2,1-3H3,(H,22,29)(H,24,25)/b23-12+ |
| InChIKey | RZAFOEKYPHHQMX-FSJBWODESA-N |
| XLogP | 2.48 |
| TPSA | 171.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|