C20H22N8O2S — CID 17076082
N-(3-acetamidophenyl)-2-[[4-amino-5-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17076082) has the molecular formula C20H22N8O2S and a molecular weight of 438.52 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-[[4-amino-5-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-acetamidophenyl)-2-[[4-amino-5-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17076082 |
| Molecular Formula | C20H22N8O2S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-(3-acetamidophenyl)-2-[[4-amino-5-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CSc2nnc(N/N=C(\C)c3ccccc3)n2N)c1 |
| InChI | InChI=1S/C20H22N8O2S/c1-13(15-7-4-3-5-8-15)24-25-19-26-27-20(28(19)21)31-12-18(30)23-17-10-6-9-16(11-17)22-14(2)29/h3-11H,12,21H2,1-2H3,(H,22,29)(H,23,30)(H,25,26)/b24-13+ |
| InChIKey | DAPXZHPNBJRAOO-ZMOGYAJESA-N |
| XLogP | 2.52 |
| TPSA | 139.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|