C16H18N8OS2 — CID 17076131
2-[[4-amino-5-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 17076131) has the molecular formula C16H18N8OS2 and a molecular weight of 402.51 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 17076131 |
| Molecular Formula | C16H18N8OS2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | C/C(=N\Nc1nnc(SCC(=O)Nc2nc(C)cs2)n1N)c1ccccc1 |
| InChI | InChI=1S/C16H18N8OS2/c1-10-8-26-15(18-10)19-13(25)9-27-16-23-22-14(24(16)17)21-20-11(2)12-6-4-3-5-7-12/h3-8H,9,17H2,1-2H3,(H,21,22)(H,18,19,25)/b20-11+ |
| InChIKey | NKGCZHWZSWRUGV-RGVLZGJSSA-N |
| XLogP | 2.32 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|