C19H21N7OS2 — CID 17076150
2-[[4-amino-5-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylsulfanylphenyl)acetamide (PubChem CID 17076150) has the molecular formula C19H21N7OS2 and a molecular weight of 427.56 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 17076150 |
| Molecular Formula | C19H21N7OS2 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylsulfanylphenyl)acetamide |
| SMILES | CSc1ccccc1NC(=O)CSc1nnc(N/N=C(\C)c2ccccc2)n1N |
| InChI | InChI=1S/C19H21N7OS2/c1-13(14-8-4-3-5-9-14)22-23-18-24-25-19(26(18)20)29-12-17(27)21-15-10-6-7-11-16(15)28-2/h3-11H,12,20H2,1-2H3,(H,21,27)(H,23,24)/b22-13+ |
| InChIKey | GVVAGQFHAQIMCG-LPYMAVHISA-N |
| XLogP | 3.28 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|