C17H17BrN8OS — CID 17076554
2-[[4-amino-5-[(2E)-2-(1-pyridin-4-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-bromophenyl)acetamide (PubChem CID 17076554) has the molecular formula C17H17BrN8OS and a molecular weight of 461.35 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-(1-pyridin-4-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-bromophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-(1-pyridin-4-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-bromophenyl)acetamide |
|---|---|
| PubChem CID | 17076554 |
| Molecular Formula | C17H17BrN8OS |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-(1-pyridin-4-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-bromophenyl)acetamide |
| SMILES | C/C(=N\Nc1nnc(SCC(=O)Nc2ccccc2Br)n1N)c1ccncc1 |
| InChI | InChI=1S/C17H17BrN8OS/c1-11(12-6-8-20-9-7-12)22-23-16-24-25-17(26(16)19)28-10-15(27)21-14-5-3-2-4-13(14)18/h2-9H,10,19H2,1H3,(H,21,27)(H,23,24)/b22-11+ |
| InChIKey | KJZBQPLYRZBFJZ-SSDVNMTOSA-N |
| XLogP | 2.72 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|