C18H19N7OS — CID 28875252
2-[[4-amino-5-[(2Z)-2-(1-pyridin-4-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(4-methylphenyl)ethanone (PubChem CID 28875252) has the molecular formula C18H19N7OS and a molecular weight of 381.47 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2Z)-2-(1-pyridin-4-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(4-methylphenyl)ethanone.
| Compound Name | 2-[[4-amino-5-[(2Z)-2-(1-pyridin-4-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 28875252 |
| Molecular Formula | C18H19N7OS |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-[[4-amino-5-[(2Z)-2-(1-pyridin-4-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(4-methylphenyl)ethanone |
| SMILES | C/C(=N/Nc1nnc(SCC(=O)c2ccc(C)cc2)n1N)c1ccncc1 |
| InChI | InChI=1S/C18H19N7OS/c1-12-3-5-15(6-4-12)16(26)11-27-18-24-23-17(25(18)19)22-21-13(2)14-7-9-20-10-8-14/h3-10H,11,19H2,1-2H3,(H,22,23)/b21-13- |
| InChIKey | DAKWRSWWGRJFID-BKUYFWCQSA-N |
| XLogP | 2.51 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|