C17H18N6S — CID 28693681
5-benzylsulfanyl-3-N-[(Z)-1-phenylethylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 28693681) has the molecular formula C17H18N6S and a molecular weight of 338.44 g/mol. Its IUPAC name is 5-benzylsulfanyl-3-N-[(Z)-1-phenylethylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-benzylsulfanyl-3-N-[(Z)-1-phenylethylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 28693681 |
| Molecular Formula | C17H18N6S |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 5-benzylsulfanyl-3-N-[(Z)-1-phenylethylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | C/C(=N/Nc1nnc(SCc2ccccc2)n1N)c1ccccc1 |
| InChI | InChI=1S/C17H18N6S/c1-13(15-10-6-3-7-11-15)19-20-16-21-22-17(23(16)18)24-12-14-8-4-2-5-9-14/h2-11H,12,18H2,1H3,(H,20,21)/b19-13- |
| InChIKey | YGOLVAWCNOBVOU-UYRXBGFRSA-N |
| XLogP | 3.12 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|