C18H19BrN6S — CID 17076265
3-N-[(E)-1-(4-bromophenyl)ethylideneamino]-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine (PubChem CID 17076265) has the molecular formula C18H19BrN6S and a molecular weight of 431.36 g/mol. Its IUPAC name is 3-N-[(E)-1-(4-bromophenyl)ethylideneamino]-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(E)-1-(4-bromophenyl)ethylideneamino]-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 17076265 |
| Molecular Formula | C18H19BrN6S |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 3-N-[(E)-1-(4-bromophenyl)ethylideneamino]-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine |
| SMILES | C/C(=N\Nc1nnc(SCc2ccccc2C)n1N)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H19BrN6S/c1-12-5-3-4-6-15(12)11-26-18-24-23-17(25(18)20)22-21-13(2)14-7-9-16(19)10-8-14/h3-10H,11,20H2,1-2H3,(H,22,23)/b21-13+ |
| InChIKey | QOGAZETZNSSSFX-FYJGNVAPSA-N |
| XLogP | 4.19 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|