C17H19N7S — CID 17076580
5-[(3-methylphenyl)methylsulfanyl]-3-N-[(E)-1-pyridin-4-ylethylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 17076580) has the molecular formula C17H19N7S and a molecular weight of 353.46 g/mol. Its IUPAC name is 5-[(3-methylphenyl)methylsulfanyl]-3-N-[(E)-1-pyridin-4-ylethylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-[(3-methylphenyl)methylsulfanyl]-3-N-[(E)-1-pyridin-4-ylethylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 17076580 |
| Molecular Formula | C17H19N7S |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 5-[(3-methylphenyl)methylsulfanyl]-3-N-[(E)-1-pyridin-4-ylethylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | C/C(=N\Nc1nnc(SCc2cccc(C)c2)n1N)c1ccncc1 |
| InChI | InChI=1S/C17H19N7S/c1-12-4-3-5-14(10-12)11-25-17-23-22-16(24(17)18)21-20-13(2)15-6-8-19-9-7-15/h3-10H,11,18H2,1-2H3,(H,21,22)/b20-13+ |
| InChIKey | WJSHQDQNFGFPRF-DEDYPNTBSA-N |
| XLogP | 2.82 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|