C15H16N6S2 — CID 17076728
5-benzylsulfanyl-3-N-[(E)-1-thiophen-2-ylethylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 17076728) has the molecular formula C15H16N6S2 and a molecular weight of 344.47 g/mol. Its IUPAC name is 5-benzylsulfanyl-3-N-[(E)-1-thiophen-2-ylethylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-benzylsulfanyl-3-N-[(E)-1-thiophen-2-ylethylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 17076728 |
| Molecular Formula | C15H16N6S2 |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 5-benzylsulfanyl-3-N-[(E)-1-thiophen-2-ylethylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | C/C(=N\Nc1nnc(SCc2ccccc2)n1N)c1cccs1 |
| InChI | InChI=1S/C15H16N6S2/c1-11(13-8-5-9-22-13)17-18-14-19-20-15(21(14)16)23-10-12-6-3-2-4-7-12/h2-9H,10,16H2,1H3,(H,18,19)/b17-11+ |
| InChIKey | ADCAOWSRPFWNOB-GZTJUZNOSA-N |
| XLogP | 3.18 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|