C18H19FN6S — CID 17076188
5-[(4-fluorophenyl)methylsulfanyl]-3-N-[(Z)-1-phenylpropylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 17076188) has the molecular formula C18H19FN6S and a molecular weight of 370.46 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methylsulfanyl]-3-N-[(Z)-1-phenylpropylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-[(4-fluorophenyl)methylsulfanyl]-3-N-[(Z)-1-phenylpropylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 17076188 |
| Molecular Formula | C18H19FN6S |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 5-[(4-fluorophenyl)methylsulfanyl]-3-N-[(Z)-1-phenylpropylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | CC/C(=N/Nc1nnc(SCc2ccc(F)cc2)n1N)c1ccccc1 |
| InChI | InChI=1S/C18H19FN6S/c1-2-16(14-6-4-3-5-7-14)21-22-17-23-24-18(25(17)20)26-12-13-8-10-15(19)11-9-13/h3-11H,2,12,20H2,1H3,(H,22,23)/b21-16- |
| InChIKey | DSAAFBBLGDUYGB-PGMHBOJBSA-N |
| XLogP | 3.65 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|