C16H13Cl2FN6S — CID 17049522
3-N-[(E)-(2,4-dichlorophenyl)methylideneamino]-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine (PubChem CID 17049522) has the molecular formula C16H13Cl2FN6S and a molecular weight of 411.29 g/mol. Its IUPAC name is 3-N-[(E)-(2,4-dichlorophenyl)methylideneamino]-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(E)-(2,4-dichlorophenyl)methylideneamino]-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 17049522 |
| Molecular Formula | C16H13Cl2FN6S |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 3-N-[(E)-(2,4-dichlorophenyl)methylideneamino]-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine |
| SMILES | Nn1c(N/N=C/c2ccc(Cl)cc2Cl)nnc1SCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H13Cl2FN6S/c17-12-4-3-11(14(18)7-12)8-21-22-15-23-24-16(25(15)20)26-9-10-1-5-13(19)6-2-10/h1-8H,9,20H2,(H,22,23)/b21-8+ |
| InChIKey | BMLDIVMXVBYTGC-ODCIPOBUSA-N |
| XLogP | 4.18 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|