C21H23Cl2N7OS — CID 17049532
2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-butan-2-ylphenyl)acetamide (PubChem CID 17049532) has the molecular formula C21H23Cl2N7OS and a molecular weight of 492.44 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-butan-2-ylphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-butan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 17049532 |
| Molecular Formula | C21H23Cl2N7OS |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-butan-2-ylphenyl)acetamide |
| SMILES | CCC(C)c1ccc(NC(=O)CSc2nnc(N/N=C/c3ccc(Cl)cc3Cl)n2N)cc1 |
| InChI | InChI=1S/C21H23Cl2N7OS/c1-3-13(2)14-5-8-17(9-6-14)26-19(31)12-32-21-29-28-20(30(21)24)27-25-11-15-4-7-16(22)10-18(15)23/h4-11,13H,3,12,24H2,1-2H3,(H,26,31)(H,27,28)/b25-11+ |
| InChIKey | PRFCVNLGGDIGDB-OPEKNORGSA-N |
| XLogP | 4.99 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|