C18H16Cl2N6O2S — CID 17049515
2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3-methoxyphenyl)ethanone (PubChem CID 17049515) has the molecular formula C18H16Cl2N6O2S and a molecular weight of 451.34 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3-methoxyphenyl)ethanone.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 17049515 |
| Molecular Formula | C18H16Cl2N6O2S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(C(=O)CSc2nnc(N/N=C/c3ccc(Cl)cc3Cl)n2N)c1 |
| InChI | InChI=1S/C18H16Cl2N6O2S/c1-28-14-4-2-3-11(7-14)16(27)10-29-18-25-24-17(26(18)21)23-22-9-12-5-6-13(19)8-15(12)20/h2-9H,10,21H2,1H3,(H,23,24)/b22-9+ |
| InChIKey | ZXIXCCZMROALHW-LSFURLLWSA-N |
| XLogP | 3.73 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|